CAS 19746-37-3 appears in our catalog under these names: Boc–Cys(Acm)–OH, Boc-L-Cys(Acm)-OH, Boc-Cys(Acm)-OH, S-(Acetamidomethyl)-N-(tert-butoxycarbonyl)-L-cysteine, >98.0%(HPLC)(T), Boc-Cys(Acm)-OH 98%. Offered by: GLPBio, Iris Biotech, Biosynth, TCI, Ambeed. Available pack sizes: 100g, 25g, 5g, 1g, 500g, 50g, 250g, 10g.
(2R)-3-(acetamidomethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 19746-37-3) is a chemical compound with the molecular formula C11H20N2O5S and a molecular weight of 292.35 g/mol. IUPAC name: (2R)-3-(acetamidomethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: HLCTYBOTPCIHTG-QMMMGPOBSA-N.
| Molecular formula | C11H20N2O5S |
|---|---|
| Molecular weight | 292.35 g/mol |
| IUPAC name | (2R)-3-(acetamidomethylsulfanyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | HLCTYBOTPCIHTG-QMMMGPOBSA-N |
| SMILES | CC(=O)NCSC[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)