Products 256474-26-7
CAS 256474-26-7 is the registry number for (2S)-2-(3,4-Dichlorophenyl)oxirane. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2S)-2-(3,4-dichlorophenyl)oxirane (CAS 256474-26-7) is a chemical compound with the molecular formula C8H6Cl2O and a molecular weight of 189.04 g/mol. IUPAC name: (2S)-2-(3,4-dichlorophenyl)oxirane. InChIKey: HIOFHWTUAOODBJ-MRVPVSSYSA-N.
| Molecular formula | C8H6Cl2O |
|---|---|
| Molecular weight | 189.04 g/mol |
| IUPAC name | (2S)-2-(3,4-dichlorophenyl)oxirane |
| InChIKey | HIOFHWTUAOODBJ-MRVPVSSYSA-N |
| SMILES | C1[C@@H](O1)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)