Products 2564806-81-9

CAS 2564806-81-9 is the registry number for 1-(tert-Butyl) 4-methyl 3-bromopiperidine-1,4-dicarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 4-O-methyl 5-bromo-3,6-dihydro-2H-pyridine-1,4-dicarboxylate (CAS 2564806-81-9) is a chemical compound with the molecular formula C12H18BrNO4 and a molecular weight of 320.18 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 5-bromo-3,6-dihydro-2H-pyridine-1,4-dicarboxylate. InChIKey: FOGGPZCCSUMZAU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18BrNO4
Molecular weight320.18 g/mol
IUPAC name1-O-tert-butyl 4-O-methyl 5-bromo-3,6-dihydro-2H-pyridine-1,4-dicarboxylate
InChIKeyFOGGPZCCSUMZAU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(=C(C1)Br)C(=O)OC

Computed by PubChem (NCBI)