CAS 2564806-81-9 is the registry number for 1-(tert-Butyl) 4-methyl 3-bromopiperidine-1,4-dicarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
1-O-tert-butyl 4-O-methyl 5-bromo-3,6-dihydro-2H-pyridine-1,4-dicarboxylate (CAS 2564806-81-9) is a chemical compound with the molecular formula C12H18BrNO4 and a molecular weight of 320.18 g/mol. IUPAC name: 1-O-tert-butyl 4-O-methyl 5-bromo-3,6-dihydro-2H-pyridine-1,4-dicarboxylate. InChIKey: FOGGPZCCSUMZAU-UHFFFAOYSA-N.
| Molecular formula | C12H18BrNO4 |
|---|---|
| Molecular weight | 320.18 g/mol |
| IUPAC name | 1-O-tert-butyl 4-O-methyl 5-bromo-3,6-dihydro-2H-pyridine-1,4-dicarboxylate |
| InChIKey | FOGGPZCCSUMZAU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=C(C1)Br)C(=O)OC |
Computed by PubChem (NCBI)