Products 2751615-71-9
CAS 2751615-71-9 is the registry number for tert-butyl N-[1-(2-bromoacetyl)-2-oxabicyclo[2.1.1]hexan-4-yl]carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[1-(2-bromoacetyl)-2-oxabicyclo[2.1.1]hexan-4-yl]carbamate (CAS 2751615-71-9) is a chemical compound with the molecular formula C12H18BrNO4 and a molecular weight of 320.18 g/mol. IUPAC name: tert-butyl N-[1-(2-bromoacetyl)-2-oxabicyclo[2.1.1]hexan-4-yl]carbamate. InChIKey: JNEILPSIXNWBTL-UHFFFAOYSA-N.
| Molecular formula | C12H18BrNO4 |
|---|---|
| Molecular weight | 320.18 g/mol |
| IUPAC name | tert-butyl N-[1-(2-bromoacetyl)-2-oxabicyclo[2.1.1]hexan-4-yl]carbamate |
| InChIKey | JNEILPSIXNWBTL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CC(C1)(OC2)C(=O)CBr |
Computed by PubChem (NCBI)