CAS 2565792-65-4 is the registry number for Ethyl (2S,4R)-4-hydroxytetrahydro-2H-pyran-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2S,4R)-4-hydroxyoxane-2-carboxylate (CAS 2565792-65-4) is a chemical compound with the molecular formula C8H14O4 and a molecular weight of 174.19 g/mol. IUPAC name: ethyl (2S,4R)-4-hydroxyoxane-2-carboxylate. InChIKey: QTTRVQVEPJZWQD-RQJHMYQMSA-N.
| Molecular formula | C8H14O4 |
|---|---|
| Molecular weight | 174.19 g/mol |
| IUPAC name | ethyl (2S,4R)-4-hydroxyoxane-2-carboxylate |
| InChIKey | QTTRVQVEPJZWQD-RQJHMYQMSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@@H](CCO1)O |
Computed by PubChem (NCBI)