Products 2566-58-7
CAS 2566-58-7 is the registry number for Bicyclo[2.2.1]heptane-2-carboxylic acid, (1R,2R,4S)-, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(1R,2R,4S)-bicyclo[2.2.1]heptane-2-carboxylic acid (CAS 2566-58-7) is a chemical compound with the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. IUPAC name: (1R,2R,4S)-bicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: JESWDXIHOJGWBP-RRKCRQDMSA-N.
| Molecular formula | C8H12O2 |
|---|---|
| Molecular weight | 140.18 g/mol |
| IUPAC name | (1R,2R,4S)-bicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | JESWDXIHOJGWBP-RRKCRQDMSA-N |
| SMILES | C1C[C@@H]2C[C@H]1C[C@H]2C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
rac-(1R,2R,4S)-bicyclo[2.2.1]heptane-2-carboxylic acid, rac-(1R,2R,4S)-bicyclo(2.2.1)heptane-2-carboxylic acid, Rel-(1R,2R,4S)-bicyclo[2.2.1]heptane-2-carboxylic acid, (1R,2R,4S)-bicyclo[2.2.1]heptane-2-carboxylic acid, Bicyclo[2.2.1]heptane-2-carboxylic acid, (1R,2R,4S)-, exo-(1R,2R,4S)-Bicyclo[2.2.1]heptane-2-carboxylic acid