CAS 870708-34-2 is the registry number for (1S,4R)-Bicyclo[2.2.1]heptane-2-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,4R)-bicyclo[2.2.1]heptane-2-carboxylic acid (CAS 870708-34-2) is a chemical compound with the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. IUPAC name: (1S,4R)-bicyclo[2.2.1]heptane-2-carboxylic acid. InChIKey: JESWDXIHOJGWBP-JEAXJGTLSA-N.
| Molecular formula | C8H12O2 |
|---|---|
| Molecular weight | 140.18 g/mol |
| IUPAC name | (1S,4R)-bicyclo[2.2.1]heptane-2-carboxylic acid |
| InChIKey | JESWDXIHOJGWBP-JEAXJGTLSA-N |
| SMILES | C1C[C@H]2C[C@@H]1CC2C(=O)O |
Computed by PubChem (NCBI)