CAS 2566240-48-8 is the registry number for (S)–2–(3–Chloro–5–fluorophenyl)piperidine hydrochloride. Offered by: GLPBio. Available pack sizes: 100mg.
(2S)-2-(3-chloro-5-fluorophenyl)piperidine;hydrochloride (CAS 2566240-48-8) is a chemical compound with the molecular formula C11H14Cl2FN and a molecular weight of 250.14 g/mol. IUPAC name: (2S)-2-(3-chloro-5-fluorophenyl)piperidine;hydrochloride. InChIKey: BJYLMKIEULDPME-MERQFXBCSA-N.
| Molecular formula | C11H14Cl2FN |
|---|---|
| Molecular weight | 250.14 g/mol |
| IUPAC name | (2S)-2-(3-chloro-5-fluorophenyl)piperidine;hydrochloride |
| InChIKey | BJYLMKIEULDPME-MERQFXBCSA-N |
| SMILES | C1CCN[C@@H](C1)C2=CC(=CC(=C2)Cl)F.Cl |
Computed by PubChem (NCBI)