CAS 324002-51-9 appears in our catalog under these names: 4-(4-Chlorophenyl)-4-fluoropiperidine hydrochloride, 95%, 4-(4-Chlorophenyl)-4-fluoropiperidine hcl, 95%, 4–(4–chlorophenyl)–4–fluoropiperidine hydrochloride, 4-(4-chlorophenyl)-4-fluoropiperidine hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 50mg, 0,5g.
4-(4-chlorophenyl)-4-fluoropiperidine;hydrochloride (CAS 324002-51-9) is a chemical compound with the molecular formula C11H14Cl2FN and a molecular weight of 250.14 g/mol. IUPAC name: 4-(4-chlorophenyl)-4-fluoropiperidine;hydrochloride. InChIKey: BZJGKQQCQMOFIS-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2FN |
|---|---|
| Molecular weight | 250.14 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-4-fluoropiperidine;hydrochloride |
| InChIKey | BZJGKQQCQMOFIS-UHFFFAOYSA-N |
| SMILES | C1CNCCC1(C2=CC=C(C=C2)Cl)F.Cl |
Computed by PubChem (NCBI)