Products 2566267-75-0
CAS 2566267-75-0 is the registry number for tert-Butyl (S)-3-amino-3-(trifluoromethyl)pyrrolidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl (3S)-3-amino-3-(trifluoromethyl)pyrrolidine-1-carboxylate (CAS 2566267-75-0) is a chemical compound with the molecular formula C10H17F3N2O2 and a molecular weight of 254.25 g/mol. IUPAC name: tert-butyl (3S)-3-amino-3-(trifluoromethyl)pyrrolidine-1-carboxylate. InChIKey: YHPCKIFBYOPVAL-VIFPVBQESA-N.
| Molecular formula | C10H17F3N2O2 |
|---|---|
| Molecular weight | 254.25 g/mol |
| IUPAC name | tert-butyl (3S)-3-amino-3-(trifluoromethyl)pyrrolidine-1-carboxylate |
| InChIKey | YHPCKIFBYOPVAL-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@](C1)(C(F)(F)F)N |
Computed by PubChem (NCBI)