CAS 256651-54-4 is the registry number for 1-{((2,6-Dibromophenyl)methyl)sulfanyl}ethan-1-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
S-[(2,6-dibromophenyl)methyl] ethanethioate (CAS 256651-54-4) is a chemical compound with the molecular formula C9H8Br2OS and a molecular weight of 324.03 g/mol. IUPAC name: S-[(2,6-dibromophenyl)methyl] ethanethioate. InChIKey: OVEBYZOYACCTQF-UHFFFAOYSA-N.
| Molecular formula | C9H8Br2OS |
|---|---|
| Molecular weight | 324.03 g/mol |
| IUPAC name | S-[(2,6-dibromophenyl)methyl] ethanethioate |
| InChIKey | OVEBYZOYACCTQF-UHFFFAOYSA-N |
| SMILES | CC(=O)SCC1=C(C=CC=C1Br)Br |
Computed by PubChem (NCBI)