Products 3323-78-2

CAS 3323-78-2 is the registry number for 2,2-Dibromo-1-[4-(methylthio)phenyl]ethanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg.

Structural formula: {0} (CAS {1})

2,2-dibromo-1-(4-methylsulfanylphenyl)ethanone (CAS 3323-78-2) is a chemical compound with the molecular formula C9H8Br2OS and a molecular weight of 324.03 g/mol. IUPAC name: 2,2-dibromo-1-(4-methylsulfanylphenyl)ethanone. InChIKey: QQTPQWNXLPJDPN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8Br2OS
Molecular weight324.03 g/mol
IUPAC name2,2-dibromo-1-(4-methylsulfanylphenyl)ethanone
InChIKeyQQTPQWNXLPJDPN-UHFFFAOYSA-N
SMILESCSC1=CC=C(C=C1)C(=O)C(Br)Br

Computed by PubChem (NCBI)