CAS 25666-51-7 appears in our catalog under these names: 2-Trifluoroacetylphenol, 95%, 2-Trifluoroacetylphenol, 98%, 2,2,2-Trifluoro-1-(2-hydroxyphenyl)ethan-1-one, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
2,2,2-trifluoro-1-(2-hydroxyphenyl)ethanone (CAS 25666-51-7) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: 2,2,2-trifluoro-1-(2-hydroxyphenyl)ethanone. InChIKey: HZRXGWSUNPYCQM-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2 |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(2-hydroxyphenyl)ethanone |
| InChIKey | HZRXGWSUNPYCQM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C(F)(F)F)O |
Computed by PubChem (NCBI)