Products 2566672-50-0
CAS 2566672-50-0 is the registry number for 4-(3-Bromoimidazo[1,2-a]pyridin-6-yl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(3-bromoimidazo[1,2-a]pyridin-6-yl)benzoic acid (CAS 2566672-50-0) is a chemical compound with the molecular formula C14H9BrN2O2 and a molecular weight of 317.14 g/mol. IUPAC name: 4-(3-bromoimidazo[1,2-a]pyridin-6-yl)benzoic acid. InChIKey: HZLYINUGZFVYKI-UHFFFAOYSA-N.
| Molecular formula | C14H9BrN2O2 |
|---|---|
| Molecular weight | 317.14 g/mol |
| IUPAC name | 4-(3-bromoimidazo[1,2-a]pyridin-6-yl)benzoic acid |
| InChIKey | HZLYINUGZFVYKI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN3C(=NC=C3Br)C=C2)C(=O)O |
Computed by PubChem (NCBI)