Products 885275-47-8
CAS 885275-47-8 is the registry number for 1-(4-Bromo-phenyl)-1H-indazole-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 5000mg, 1000mg.
1-(4-bromophenyl)indazole-3-carboxylic acid (CAS 885275-47-8) is a chemical compound with the molecular formula C14H9BrN2O2 and a molecular weight of 317.14 g/mol. IUPAC name: 1-(4-bromophenyl)indazole-3-carboxylic acid. InChIKey: SJSWGEBZCIMQKT-UHFFFAOYSA-N.
| Molecular formula | C14H9BrN2O2 |
|---|---|
| Molecular weight | 317.14 g/mol |
| IUPAC name | 1-(4-bromophenyl)indazole-3-carboxylic acid |
| InChIKey | SJSWGEBZCIMQKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN2C3=CC=C(C=C3)Br)C(=O)O |
Computed by PubChem (NCBI)