CAS 2567-51-3 is the registry number for N,N-Dibenzylchloroacetamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
N,N-dibenzyl-2-chloroacetamide (CAS 2567-51-3) is a chemical compound with the molecular formula C16H16ClNO and a molecular weight of 273.75 g/mol. IUPAC name: N,N-dibenzyl-2-chloroacetamide. InChIKey: OVWIRORWDCWBCF-UHFFFAOYSA-N.
| Molecular formula | C16H16ClNO |
|---|---|
| Molecular weight | 273.75 g/mol |
| IUPAC name | N,N-dibenzyl-2-chloroacetamide |
| InChIKey | OVWIRORWDCWBCF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC=CC=C2)C(=O)CCl |
Computed by PubChem (NCBI)