CAS 726150-60-3 is the registry number for 2-Chloro-n-(2,5-dimethylphenyl)-2-phenylacetamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-N-(2,5-dimethylphenyl)-2-phenylacetamide (CAS 726150-60-3) is a chemical compound with the molecular formula C16H16ClNO and a molecular weight of 273.75 g/mol. IUPAC name: 2-chloro-N-(2,5-dimethylphenyl)-2-phenylacetamide. InChIKey: UUODHHRXDZDTHO-UHFFFAOYSA-N.
| Molecular formula | C16H16ClNO |
|---|---|
| Molecular weight | 273.75 g/mol |
| IUPAC name | 2-chloro-N-(2,5-dimethylphenyl)-2-phenylacetamide |
| InChIKey | UUODHHRXDZDTHO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)NC(=O)C(C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)