CAS 2567560-45-4 is the registry number for 2-(Trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine (CAS 2567560-45-4) is a chemical compound with the molecular formula C8H8F3NS and a molecular weight of 207.22 g/mol. IUPAC name: 2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine. InChIKey: IPYWFXBSZIYXDI-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NS |
|---|---|
| Molecular weight | 207.22 g/mol |
| IUPAC name | 2-(trifluoromethyl)-5,6-dihydro-4H-cyclopenta[b]thiophen-3-amine |
| InChIKey | IPYWFXBSZIYXDI-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)SC(=C2N)C(F)(F)F |
Computed by PubChem (NCBI)