CAS 99229-16-0 is the registry number for 2-[(2,2,2-Trifluoroethyl)thio]aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-(2,2,2-trifluoroethylsulfanyl)aniline (CAS 99229-16-0) is a chemical compound with the molecular formula C8H8F3NS and a molecular weight of 207.22 g/mol. IUPAC name: 2-(2,2,2-trifluoroethylsulfanyl)aniline. InChIKey: HENBDRLKMRCDES-UHFFFAOYSA-N.
| Molecular formula | C8H8F3NS |
|---|---|
| Molecular weight | 207.22 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethylsulfanyl)aniline |
| InChIKey | HENBDRLKMRCDES-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)SCC(F)(F)F |
Computed by PubChem (NCBI)