Products 25677-69-4
CAS 25677-69-4 appears in our catalog under these names: 2,9–Diphenyl–1,10–phenanthroline, 2,9-Diphenyl-1,10-phenanthroline, 2,9-Diphenyl-1,10-phenanthroline, >98.0%(HPLC)(T), 2,9-Diphenyl-1,10-phenanthroline 98%, 2,9-Diphenyl-1,10-phenanthroline, 98%, 98%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 0,1g, 0,05g, 0,25g, 0,5g.
2,9-diphenyl-1,10-phenanthroline (CAS 25677-69-4) is a chemical compound with the molecular formula C24H16N2 and a molecular weight of 332.4 g/mol. IUPAC name: 2,9-diphenyl-1,10-phenanthroline. InChIKey: HVCVRVKEIKXBIF-UHFFFAOYSA-N.
| Molecular formula | C24H16N2 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 2,9-diphenyl-1,10-phenanthroline |
| InChIKey | HVCVRVKEIKXBIF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C=CC4=C3N=C(C=C4)C5=CC=CC=C5)C=C2 |
Computed by PubChem (NCBI)