Products 2570255-85-3
CAS 2570255-85-3 is the registry number for Sinulatumolin E. Offered by: TargetMol, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, Get quote.
(1S,8S,10aS)-8-hydroxy-1,9,10a-trimethyl-1,2,3,5,6,8-hexahydrobenzo[8]annulen-7-one (CAS 2570255-85-3) is a chemical compound with the molecular formula C15H22O2 and a molecular weight of 234.33 g/mol. IUPAC name: (1S,8S,10aS)-8-hydroxy-1,9,10a-trimethyl-1,2,3,5,6,8-hexahydrobenzo[8]annulen-7-one. InChIKey: BMUCJOJWXLJQSG-TUKIKUTGSA-N.
| Molecular formula | C15H22O2 |
|---|---|
| Molecular weight | 234.33 g/mol |
| IUPAC name | (1S,8S,10aS)-8-hydroxy-1,9,10a-trimethyl-1,2,3,5,6,8-hexahydrobenzo[8]annulen-7-one |
| InChIKey | BMUCJOJWXLJQSG-TUKIKUTGSA-N |
| SMILES | C[C@H]1CCC=C2[C@@]1(C=C([C@@H](C(=O)CC2)O)C)C |
Computed by PubChem (NCBI)
Synonyms:
Sinulatumolin E, orb1744657