CAS 257285-02-2 is the registry number for 1-(2-Bromo-4-(trifluoromethoxy)phenyl)-2,5-dimethyl-1H-pyrrole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2-bromo-4-(trifluoromethoxy)phenyl]-2,5-dimethylpyrrole (CAS 257285-02-2) is a chemical compound with the molecular formula C13H11BrF3NO and a molecular weight of 334.13 g/mol. IUPAC name: 1-[2-bromo-4-(trifluoromethoxy)phenyl]-2,5-dimethylpyrrole. InChIKey: WYUNFFFYRXWGIH-UHFFFAOYSA-N.
| Molecular formula | C13H11BrF3NO |
|---|---|
| Molecular weight | 334.13 g/mol |
| IUPAC name | 1-[2-bromo-4-(trifluoromethoxy)phenyl]-2,5-dimethylpyrrole |
| InChIKey | WYUNFFFYRXWGIH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=C(C=C(C=C2)OC(F)(F)F)Br)C |
Computed by PubChem (NCBI)