Products 51924-70-0
CAS 51924-70-0 is the registry number for 2-bromo-3-((3-(trifluoromethyl)phenyl)amino)cyclohex-2-en-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
2-bromo-3-[3-(trifluoromethyl)anilino]cyclohex-2-en-1-one (CAS 51924-70-0) is a chemical compound with the molecular formula C13H11BrF3NO and a molecular weight of 334.13 g/mol. IUPAC name: 2-bromo-3-[3-(trifluoromethyl)anilino]cyclohex-2-en-1-one. InChIKey: UAHABKZCGNTNNC-UHFFFAOYSA-N.
| Molecular formula | C13H11BrF3NO |
|---|---|
| Molecular weight | 334.13 g/mol |
| IUPAC name | 2-bromo-3-[3-(trifluoromethyl)anilino]cyclohex-2-en-1-one |
| InChIKey | UAHABKZCGNTNNC-UHFFFAOYSA-N |
| SMILES | C1CC(=C(C(=O)C1)Br)NC2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)