Products 2573212-77-6
CAS 2573212-77-6 is the registry number for 2-Chloro-1-(4-methyl-3-oxaspiro[bicyclo[2.1.1]hexane-2,3'-oxetan]-1-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-1-(1-methylspiro[2-oxabicyclo[2.1.1]hexane-3,3'-oxetane]-4-yl)ethanone (CAS 2573212-77-6) is a chemical compound with the molecular formula C10H13ClO3 and a molecular weight of 216.66 g/mol. IUPAC name: 2-chloro-1-(1-methylspiro[2-oxabicyclo[2.1.1]hexane-3,3'-oxetane]-4-yl)ethanone. InChIKey: VQWFLBVIWWOBFG-UHFFFAOYSA-N.
| Molecular formula | C10H13ClO3 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | 2-chloro-1-(1-methylspiro[2-oxabicyclo[2.1.1]hexane-3,3'-oxetane]-4-yl)ethanone |
| InChIKey | VQWFLBVIWWOBFG-UHFFFAOYSA-N |
| SMILES | CC12CC(C1)(C3(O2)COC3)C(=O)CCl |
Computed by PubChem (NCBI)