Products 2575731-47-2
CAS 2575731-47-2 is the registry number for ETAP. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[2-[4-(4-ethylphenyl)triazol-1-yl]phenyl]ethanone (CAS 2575731-47-2) is a chemical compound with the molecular formula C18H17N3O and a molecular weight of 291.3 g/mol. IUPAC name: 1-[2-[4-(4-ethylphenyl)triazol-1-yl]phenyl]ethanone. InChIKey: QPOAHTRZQUAMRS-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | 1-[2-[4-(4-ethylphenyl)triazol-1-yl]phenyl]ethanone |
| InChIKey | QPOAHTRZQUAMRS-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=CN(N=N2)C3=CC=CC=C3C(=O)C |
Computed by PubChem (NCBI)
Synonyms:
ETAP, orb1944301