CAS 2576-92-3 is the registry number for R*,S*-Isoetharine Hydrochloride. Offered by: TRC. Available pack sizes: 2,5g.
4-[(1S,2R)-1-hydroxy-2-(propan-2-ylamino)butyl]benzene-1,2-diol;hydrochloride (CAS 2576-92-3) is a chemical compound with the molecular formula C13H22ClNO3 and a molecular weight of 275.77 g/mol. IUPAC name: 4-[(1S,2R)-1-hydroxy-2-(propan-2-ylamino)butyl]benzene-1,2-diol;hydrochloride. InChIKey: MUFDLGGSOCHQOC-HTKOBJQYSA-N.
| Molecular formula | C13H22ClNO3 |
|---|---|
| Molecular weight | 275.77 g/mol |
| IUPAC name | 4-[(1S,2R)-1-hydroxy-2-(propan-2-ylamino)butyl]benzene-1,2-diol;hydrochloride |
| InChIKey | MUFDLGGSOCHQOC-HTKOBJQYSA-N |
| SMILES | CC[C@H]([C@H](C1=CC(=C(C=C1)O)O)O)NC(C)C.Cl |
Computed by PubChem (NCBI)