CAS 257610-86-9 appears in our catalog under these names: 2-tert-Butyl 4-ethyl 5-amino-3-methylthiophene-2,4-dicarboxylate, 95%, 2-tert-Butyl 4-ethyl 5-amino-3-methylthiophene-2,4-dicarboxylate, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-O-tert-butyl 4-O-ethyl 5-amino-3-methylthiophene-2,4-dicarboxylate (CAS 257610-86-9) is a chemical compound with the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. IUPAC name: 2-O-tert-butyl 4-O-ethyl 5-amino-3-methylthiophene-2,4-dicarboxylate. InChIKey: BIYRGKXJVULHKF-UHFFFAOYSA-N.
| Molecular formula | C13H19NO4S |
|---|---|
| Molecular weight | 285.36 g/mol |
| IUPAC name | 2-O-tert-butyl 4-O-ethyl 5-amino-3-methylthiophene-2,4-dicarboxylate |
| InChIKey | BIYRGKXJVULHKF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(SC(=C1C)C(=O)OC(C)(C)C)N |
Computed by PubChem (NCBI)