CAS 2577289-51-9 is the registry number for (R,Z)-2-Fluoro-3-(1-methylpyrrolidin-2-yl)acrylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(Z)-2-fluoro-3-[(2R)-1-methylpyrrolidin-2-yl]prop-2-enoic acid (CAS 2577289-51-9) is a chemical compound with the molecular formula C8H12FNO2 and a molecular weight of 173.18 g/mol. IUPAC name: (Z)-2-fluoro-3-[(2R)-1-methylpyrrolidin-2-yl]prop-2-enoic acid. InChIKey: PLIMURDNVQTYCJ-XOQWBGJWSA-N.
| Molecular formula | C8H12FNO2 |
|---|---|
| Molecular weight | 173.18 g/mol |
| IUPAC name | (Z)-2-fluoro-3-[(2R)-1-methylpyrrolidin-2-yl]prop-2-enoic acid |
| InChIKey | PLIMURDNVQTYCJ-XOQWBGJWSA-N |
| SMILES | CN1CCC[C@@H]1/C=C(/C(=O)O)\F |
Computed by PubChem (NCBI)