CAS 2621938-56-3 is the registry number for rel-(6S,7aR)-6-Fluoro-7a-(hydroxymethyl)hexahydro-3H-pyrrolizin-3-one, 98%. Offered by: AmBeed. Available pack sizes: 5g, 250mg, 1g.
(6S,8R)-6-fluoro-8-(hydroxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (CAS 2621938-56-3) is a chemical compound with the molecular formula C8H12FNO2 and a molecular weight of 173.18 g/mol. IUPAC name: (6S,8R)-6-fluoro-8-(hydroxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one. InChIKey: HZELJNXSMOFDCC-POYBYMJQSA-N.
| Molecular formula | C8H12FNO2 |
|---|---|
| Molecular weight | 173.18 g/mol |
| IUPAC name | (6S,8R)-6-fluoro-8-(hydroxymethyl)-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| InChIKey | HZELJNXSMOFDCC-POYBYMJQSA-N |
| SMILES | C1C[C@@]2(C[C@@H](CN2C1=O)F)CO |
Computed by PubChem (NCBI)