Products 2578392-32-0
CAS 2578392-32-0 is the registry number for 6-chloro-4H-2,7-naphthyridine-1,3-dione, 94%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
6-chloro-4H-2,7-naphthyridine-1,3-dione (CAS 2578392-32-0) is a chemical compound with the molecular formula C8H5ClN2O2 and a molecular weight of 196.59 g/mol. IUPAC name: 6-chloro-4H-2,7-naphthyridine-1,3-dione. InChIKey: BKJOFOFUQPCZLY-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O2 |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 6-chloro-4H-2,7-naphthyridine-1,3-dione |
| InChIKey | BKJOFOFUQPCZLY-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=NC=C2C(=O)NC1=O)Cl |
Computed by PubChem (NCBI)