CAS 257876-11-2 is the registry number for 4-Methyl-2-(pyrazin-2-yl)thiazole-5-carbonyl chloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carbonyl chloride (CAS 257876-11-2) is a chemical compound with the molecular formula C9H6ClN3OS and a molecular weight of 239.68 g/mol. IUPAC name: 4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carbonyl chloride. InChIKey: AURNSWQWQVJINA-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3OS |
|---|---|
| Molecular weight | 239.68 g/mol |
| IUPAC name | 4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carbonyl chloride |
| InChIKey | AURNSWQWQVJINA-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=NC=CN=C2)C(=O)Cl |
Computed by PubChem (NCBI)