Products 257876-11-2

CAS 257876-11-2 is the registry number for 4-Methyl-2-(pyrazin-2-yl)thiazole-5-carbonyl chloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carbonyl chloride (CAS 257876-11-2) is a chemical compound with the molecular formula C9H6ClN3OS and a molecular weight of 239.68 g/mol. IUPAC name: 4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carbonyl chloride. InChIKey: AURNSWQWQVJINA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6ClN3OS
Molecular weight239.68 g/mol
IUPAC name4-methyl-2-pyrazin-2-yl-1,3-thiazole-5-carbonyl chloride
InChIKeyAURNSWQWQVJINA-UHFFFAOYSA-N
SMILESCC1=C(SC(=N1)C2=NC=CN=C2)C(=O)Cl

Computed by PubChem (NCBI)