CAS 603955-34-6 is the registry number for 4-Chloro-N-(thiazol-2-yl)picolinamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide (CAS 603955-34-6) is a chemical compound with the molecular formula C9H6ClN3OS and a molecular weight of 239.68 g/mol. IUPAC name: 4-chloro-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide. InChIKey: ZFNFLIUSQCZBFO-UHFFFAOYSA-N.
| Molecular formula | C9H6ClN3OS |
|---|---|
| Molecular weight | 239.68 g/mol |
| IUPAC name | 4-chloro-N-(1,3-thiazol-2-yl)pyridine-2-carboxamide |
| InChIKey | ZFNFLIUSQCZBFO-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1Cl)C(=O)NC2=NC=CS2 |
Computed by PubChem (NCBI)