Products 25799-81-9
CAS 25799-81-9 is the registry number for D-Xylose-1-phosphate triethylammonium. Offered by: Biosynth. Available pack sizes: 2mg, 1mg, 5mg, 25mg, 10mg.
[(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl] dihydrogen phosphate (CAS 25799-81-9) is a chemical compound with the molecular formula C5H11O8P and a molecular weight of 230.11 g/mol. IUPAC name: [(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl] dihydrogen phosphate. InChIKey: ILXHFXFPPZGENN-LECHCGJUSA-N.
| Molecular formula | C5H11O8P |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | [(2S,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl] dihydrogen phosphate |
| InChIKey | ILXHFXFPPZGENN-LECHCGJUSA-N |
| SMILES | C1[C@H]([C@@H]([C@H]([C@@H](O1)OP(=O)(O)O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
beta-d-xylose 1-phosphate