Products 4300-28-1
CAS 4300-28-1 is the registry number for D-Ribose 5-phosphate. Offered by: MedChemExpress. Available pack sizes: 5mg, 25mg, 10mg.
Aldehydo-D-ribose 5-phosphate is the acyclic form of D-ribose 5-phosphate. It is a conjugate acid of an aldehydo-D-ribose 5-phosphate(2-).
Source: ChEBI
| Molecular formula | C5H11O8P |
|---|---|
| Molecular weight | 230.11 g/mol |
| IUPAC name | [(2R,3R,4R)-2,3,4-trihydroxy-5-oxopentyl] dihydrogen phosphate |
| InChIKey | PPQRONHOSHZGFQ-LMVFSUKVSA-N |
| SMILES | C([C@H]([C@H]([C@H](C=O)O)O)O)OP(=O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
ribose-5-phosphate, Ribose 5-phosphate, Ribose 5-monophosphate, Ribose phosphate, 5-O-phosphono-D-ribose, Ribose, 5-(dihydrogen phosphate), D-, [(2R,3R,4R)-2,3,4-trihydroxy-5-oxopentyl] dihydrogen phosphate, ((2R,3R,4R)-2,3,4-trihydroxy-5-oxopentyl) dihydrogen phosphate, GlyTouCan:G66544KG, ribose-5-phosphoric acid, (D-ribose)-