CAS 2580099-32-5 is the registry number for rel-(1R,5R)-5-(((Benzyloxy)carbonyl)amino)-4,4-difluorocycloheptane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,5R)-4,4-difluoro-5-(phenylmethoxycarbonylamino)cycloheptane-1-carboxylic acid (CAS 2580099-32-5) is a chemical compound with the molecular formula C16H19F2NO4 and a molecular weight of 327.32 g/mol. IUPAC name: trans-(1R,5R)-4,4-difluoro-5-(phenylmethoxycarbonylamino)cycloheptane-1-carboxylic acid. InChIKey: QNHZODBTPJYKAA-CHWSQXEVSA-N.
| Molecular formula | C16H19F2NO4 |
|---|---|
| Molecular weight | 327.32 g/mol |
| IUPAC name | trans-(1R,5R)-4,4-difluoro-5-(phenylmethoxycarbonylamino)cycloheptane-1-carboxylic acid |
| InChIKey | QNHZODBTPJYKAA-CHWSQXEVSA-N |
| SMILES | C1C[C@H](C(CC[C@@H]1C(=O)O)(F)F)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)