Products 1456616-43-5
CAS 1456616-43-5 appears in our catalog under these names: Omarigliptin Impurity E, N-((2R,3R)-2-(2,5-Difluorophenyl)tetrahydro-5-oxo-2H-pyran-3-yl)carbamic Acid 1,1-Dimethylethyl Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
Tert-butyl N-[(2R,3R)-2-(2,5-difluorophenyl)-5-oxooxan-3-yl]carbamate (CAS 1456616-43-5) is a chemical compound with the molecular formula C16H19F2NO4 and a molecular weight of 327.32 g/mol. IUPAC name: tert-butyl N-[(2R,3R)-2-(2,5-difluorophenyl)-5-oxooxan-3-yl]carbamate. InChIKey: OTCULXVRRSCLLI-ZIAGYGMSSA-N.
| Molecular formula | C16H19F2NO4 |
|---|---|
| Molecular weight | 327.32 g/mol |
| IUPAC name | tert-butyl N-[(2R,3R)-2-(2,5-difluorophenyl)-5-oxooxan-3-yl]carbamate |
| InChIKey | OTCULXVRRSCLLI-ZIAGYGMSSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC(=O)CO[C@@H]1C2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)