Products 25804-49-3
CAS 25804-49-3 appears in our catalog under these names: tert-Butyl 4-hydroxybenzoate, tert-Butyl 4-hydroxybenzoate, 96%, tert-Butyl 4-hydroxybenzoate, 95%. Offered by: Biosynth, Ambeed, BLDpharm, Fluorochem, Chemat. Available pack sizes: 100g, 10g, 250mg, 1g, 5g, 25g, 500g, 1kg.
Tert-butyl 4-hydroxybenzoate (CAS 25804-49-3) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: tert-butyl 4-hydroxybenzoate. InChIKey: WHWMOMRHHQLBQQ-UHFFFAOYSA-N.
| Molecular formula | C11H14O3 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | tert-butyl 4-hydroxybenzoate |
| InChIKey | WHWMOMRHHQLBQQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)
Synonyms:
tert-Butyl 4-hydroxybenzoate, Benzoic acid, 4-hydroxy-, 1,1-dimethylethyl ester, tert-Butyl p-hydroxybenzoate, 4-Hydroxybenzoic acid tert-butyl ester, 1,1-dimethylethyl 4-hydroxybenzoate, P-HYDROXYBENZOIC ACID TERT-BUTYL ESTER, BENZOIC ACID, P-HYDROXY-, TERT-BUTYL ESTER, Tert-butyl-4-hydroxybenzoate, 4-hydroxy-benzoic acid tert-butyl ester, 4-hydroxybenzoic acid 1,1-dimethylethyl ester