Products 2581221-73-8
CAS 2581221-73-8 is the registry number for 4-Cyano-6,7-dihydro-5H-cyclopenta[c]pyridine-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-cyano-6,7-dihydro-5H-cyclopenta[c]pyridine-1-carboxylic acid (CAS 2581221-73-8) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 4-cyano-6,7-dihydro-5H-cyclopenta[c]pyridine-1-carboxylic acid. InChIKey: LCWWNGFVUHLWTE-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 4-cyano-6,7-dihydro-5H-cyclopenta[c]pyridine-1-carboxylic acid |
| InChIKey | LCWWNGFVUHLWTE-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=NC=C2C#N)C(=O)O |
Computed by PubChem (NCBI)