CAS 2581986-75-4 is the registry number for (2-(Trifluoromethoxy)pyridin-4-yl)methanamine dihydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
[2-(trifluoromethoxy)-4-pyridinyl]methanamine;dihydrochloride (CAS 2581986-75-4) is a chemical compound with the molecular formula C7H9Cl2F3N2O and a molecular weight of 265.06 g/mol. IUPAC name: [2-(trifluoromethoxy)-4-pyridinyl]methanamine;dihydrochloride. InChIKey: GOVPSISNDHMTMP-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2F3N2O |
|---|---|
| Molecular weight | 265.06 g/mol |
| IUPAC name | [2-(trifluoromethoxy)-4-pyridinyl]methanamine;dihydrochloride |
| InChIKey | GOVPSISNDHMTMP-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1CN)OC(F)(F)F.Cl.Cl |
Computed by PubChem (NCBI)