CAS 97963-69-4 appears in our catalog under these names: 4-(Trifluoromethoxy)benzene-1,2-diamine dihydrochloride, 95%, 4-(Trifluoromethoxy)benzene-1,2-diamine dihydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
4-(trifluoromethoxy)benzene-1,2-diamine;dihydrochloride (CAS 97963-69-4) is a chemical compound with the molecular formula C7H9Cl2F3N2O and a molecular weight of 265.06 g/mol. IUPAC name: 4-(trifluoromethoxy)benzene-1,2-diamine;dihydrochloride. InChIKey: XVDGHCYFJDVPMI-UHFFFAOYSA-N.
| Molecular formula | C7H9Cl2F3N2O |
|---|---|
| Molecular weight | 265.06 g/mol |
| IUPAC name | 4-(trifluoromethoxy)benzene-1,2-diamine;dihydrochloride |
| InChIKey | XVDGHCYFJDVPMI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)N)N.Cl.Cl |
Computed by PubChem (NCBI)