CAS 25844-72-8 appears in our catalog under these names: 5-Phenylpyrazin-2(1H)-one, 95+%, 5-Phenyl-1H-pyrazin-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
5-phenyl-1H-pyrazin-2-one (CAS 25844-72-8) is a chemical compound with the molecular formula C10H8N2O and a molecular weight of 172.18 g/mol. IUPAC name: 5-phenyl-1H-pyrazin-2-one. InChIKey: BMGVFXUMEAYBAO-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O |
|---|---|
| Molecular weight | 172.18 g/mol |
| IUPAC name | 5-phenyl-1H-pyrazin-2-one |
| InChIKey | BMGVFXUMEAYBAO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CNC(=O)C=N2 |
Computed by PubChem (NCBI)