Products 25860-44-0
CAS 25860-44-0 appears in our catalog under these names: 2-Phenylproline, 95%, 2-Phenylpyrrolidine-2-carboxylic acid, 98+%, 2-Phenylproline, 98%, 98%, 2-phenylproline, 98+%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 10g, 5g, 100mg.
2-phenylpyrrolidine-2-carboxylic acid (CAS 25860-44-0) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: 2-phenylpyrrolidine-2-carboxylic acid. InChIKey: CQAXKUDMMFGQDY-UHFFFAOYSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | 2-phenylpyrrolidine-2-carboxylic acid |
| InChIKey | CQAXKUDMMFGQDY-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)