CAS 2586064-31-3 is the registry number for Ethyl 2-bromo-4-formylthiazole-5-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-bromo-4-formyl-1,3-thiazole-5-carboxylate (CAS 2586064-31-3) is a chemical compound with the molecular formula C7H6BrNO3S and a molecular weight of 264.10 g/mol. IUPAC name: ethyl 2-bromo-4-formyl-1,3-thiazole-5-carboxylate. InChIKey: ZMFWKTLFEUTXNP-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3S |
|---|---|
| Molecular weight | 264.10 g/mol |
| IUPAC name | ethyl 2-bromo-4-formyl-1,3-thiazole-5-carboxylate |
| InChIKey | ZMFWKTLFEUTXNP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(S1)Br)C=O |
Computed by PubChem (NCBI)