Products 76275-88-2

CAS 76275-88-2 is the registry number for Methyl 2-(2-bromoacetyl)-1,3-thiazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Methyl 2-(2-bromoacetyl)-1,3-thiazole-4-carboxylate (CAS 76275-88-2) is a chemical compound with the molecular formula C7H6BrNO3S and a molecular weight of 264.10 g/mol. IUPAC name: methyl 2-(2-bromoacetyl)-1,3-thiazole-4-carboxylate. InChIKey: YGLQTJJQXRMSQU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H6BrNO3S
Molecular weight264.10 g/mol
IUPAC namemethyl 2-(2-bromoacetyl)-1,3-thiazole-4-carboxylate
InChIKeyYGLQTJJQXRMSQU-UHFFFAOYSA-N
SMILESCOC(=O)C1=CSC(=N1)C(=O)CBr

Computed by PubChem (NCBI)