CAS 76275-88-2 is the registry number for Methyl 2-(2-bromoacetyl)-1,3-thiazole-4-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Methyl 2-(2-bromoacetyl)-1,3-thiazole-4-carboxylate (CAS 76275-88-2) is a chemical compound with the molecular formula C7H6BrNO3S and a molecular weight of 264.10 g/mol. IUPAC name: methyl 2-(2-bromoacetyl)-1,3-thiazole-4-carboxylate. InChIKey: YGLQTJJQXRMSQU-UHFFFAOYSA-N.
| Molecular formula | C7H6BrNO3S |
|---|---|
| Molecular weight | 264.10 g/mol |
| IUPAC name | methyl 2-(2-bromoacetyl)-1,3-thiazole-4-carboxylate |
| InChIKey | YGLQTJJQXRMSQU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C(=O)CBr |
Computed by PubChem (NCBI)