Products 2586125-87-1
CAS 2586125-87-1 is the registry number for 5-Bromo-2-fluoro-3-methoxy-N,N-dimethylbenzamide, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
5-bromo-2-fluoro-3-methoxy-N,N-dimethylbenzamide (CAS 2586125-87-1) is a chemical compound with the molecular formula C10H11BrFNO2 and a molecular weight of 276.10 g/mol. IUPAC name: 5-bromo-2-fluoro-3-methoxy-N,N-dimethylbenzamide. InChIKey: OFHCYBGBROAAHS-UHFFFAOYSA-N.
| Molecular formula | C10H11BrFNO2 |
|---|---|
| Molecular weight | 276.10 g/mol |
| IUPAC name | 5-bromo-2-fluoro-3-methoxy-N,N-dimethylbenzamide |
| InChIKey | OFHCYBGBROAAHS-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=C(C(=CC(=C1)Br)OC)F |
Computed by PubChem (NCBI)