Products 2586127-23-1

CAS 2586127-23-1 is the registry number for 4-(Methoxymethoxy)-2,3-dimethylbenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(methoxymethoxy)-2,3-dimethylbenzaldehyde (CAS 2586127-23-1) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 4-(methoxymethoxy)-2,3-dimethylbenzaldehyde. InChIKey: OKIJJAWPECIAIG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O3
Molecular weight194.23 g/mol
IUPAC name4-(methoxymethoxy)-2,3-dimethylbenzaldehyde
InChIKeyOKIJJAWPECIAIG-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1C)OCOC)C=O

Computed by PubChem (NCBI)