Products 258854-65-8
CAS 258854-65-8 appears in our catalog under these names: 1α-Hydroxy-3-deoxypseudoanisatin, ≥98%, ≥98%, 1α-Hydroxy-3-deoxypseudoanisatin. Offered by: Chemat, MedChemExpress. Available pack sizes: 5mg, 5 mg, 1 mg, 10 mg.
(1R,2S,5R,6S,13R)-2,5,13-trihydroxy-2,6,13-trimethyl-8-oxatricyclo[4.4.3.01,5]tridecane-9,12-dione (CAS 258854-65-8) is a chemical compound with the molecular formula C15H22O6 and a molecular weight of 298.33 g/mol. IUPAC name: (1R,2S,5R,6S,13R)-2,5,13-trihydroxy-2,6,13-trimethyl-8-oxatricyclo[4.4.3.01,5]tridecane-9,12-dione. InChIKey: FZTKPYZYPMEOEN-FQKPHLNHSA-N.
| Molecular formula | C15H22O6 |
|---|---|
| Molecular weight | 298.33 g/mol |
| IUPAC name | (1R,2S,5R,6S,13R)-2,5,13-trihydroxy-2,6,13-trimethyl-8-oxatricyclo[4.4.3.01,5]tridecane-9,12-dione |
| InChIKey | FZTKPYZYPMEOEN-FQKPHLNHSA-N |
| SMILES | C[C@@]1(CC[C@]2([C@@]13CC(=O)[C@]([C@]2(COC(=O)C3)C)(C)O)O)O |
Computed by PubChem (NCBI)