CAS 34114-99-3 appears in our catalog under these names: T-2 Tetraol, 95%, T-2 Toxin Tetraol, T2 Tetraol, >95% (HPLC), T-2 Tetraol 50 μg/mL in Acetonitrile, T-2 Tetraol. Offered by: Combi-blocks, Chemat Brand, TRC, Dr. Ehrenstorfer, TargetMol. Available pack sizes: 1g, 5g, on request, 1mg, 2,5mg, 1ml, 100μg, 2mg.
(1S,2R,4S,7R,9R,10R,11S,12S)-2-(hydroxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-4,10,11-triol (CAS 34114-99-3) is a chemical compound with the molecular formula C15H22O6 and a molecular weight of 298.33 g/mol. IUPAC name: (1S,2R,4S,7R,9R,10R,11S,12S)-2-(hydroxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-4,10,11-triol. InChIKey: ZAXZBJSXSOISTF-LYFQSNBGSA-N.
| Molecular formula | C15H22O6 |
|---|---|
| Molecular weight | 298.33 g/mol |
| IUPAC name | (1S,2R,4S,7R,9R,10R,11S,12S)-2-(hydroxymethyl)-1,5-dimethylspiro[8-oxatricyclo[7.2.1.02,7]dodec-5-ene-12,2'-oxirane]-4,10,11-triol |
| InChIKey | ZAXZBJSXSOISTF-LYFQSNBGSA-N |
| SMILES | CC1=C[C@@H]2[C@](C[C@@H]1O)([C@]3([C@@H]([C@H]([C@H]([C@@]34CO4)O2)O)O)C)CO |
Computed by PubChem (NCBI)