CAS 2589533-43-5 is the registry number for 3-(1,1-Difluoroethyl)-7-(hydroxymethyl)quinoxalin-2(1H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1,1-difluoroethyl)-7-(hydroxymethyl)-1H-quinoxalin-2-one (CAS 2589533-43-5) is a chemical compound with the molecular formula C11H10F2N2O2 and a molecular weight of 240.21 g/mol. IUPAC name: 3-(1,1-difluoroethyl)-7-(hydroxymethyl)-1H-quinoxalin-2-one. InChIKey: NABXTZVAOKPBHI-UHFFFAOYSA-N.
| Molecular formula | C11H10F2N2O2 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 3-(1,1-difluoroethyl)-7-(hydroxymethyl)-1H-quinoxalin-2-one |
| InChIKey | NABXTZVAOKPBHI-UHFFFAOYSA-N |
| SMILES | CC(C1=NC2=C(C=C(C=C2)CO)NC1=O)(F)F |
Computed by PubChem (NCBI)