Products 1914136-73-4
CAS 1914136-73-4 appears in our catalog under these names: 3,5-Difluoro-4-(5-isopropyl-1,2,4-oxadiazol-3-yl)phenol, 97%, 97%, 3,5-Difluoro-4-(5-isopropyl-1,2,4-oxadiazol-3-yl)phenol, 97%. Offered by: Chemat, Fluorochem, Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 25g.
3,5-difluoro-4-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)phenol (CAS 1914136-73-4) is a chemical compound with the molecular formula C11H10F2N2O2 and a molecular weight of 240.21 g/mol. IUPAC name: 3,5-difluoro-4-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)phenol. InChIKey: ALIXSMOMSFSVBB-UHFFFAOYSA-N.
| Molecular formula | C11H10F2N2O2 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 3,5-difluoro-4-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)phenol |
| InChIKey | ALIXSMOMSFSVBB-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=NO1)C2=C(C=C(C=C2F)O)F |
Computed by PubChem (NCBI)